C15H24O6 — CID 134842947
[(2S,5S)-5-(methoxymethoxy)hept-6-en-2-yl] (E,5S)-5-hydroxy-4-oxohex-2-enoate (PubChem CID 134842947) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is [(2S,5S)-5-(methoxymethoxy)hept-6-en-2-yl] (E,5S)-5-hydroxy-4-oxohex-2-enoate.
| Compound Name | [(2S,5S)-5-(methoxymethoxy)hept-6-en-2-yl] (E,5S)-5-hydroxy-4-oxohex-2-enoate |
|---|---|
| PubChem CID | 134842947 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(2S,5S)-5-(methoxymethoxy)hept-6-en-2-yl] (E,5S)-5-hydroxy-4-oxohex-2-enoate |
| SMILES | C=C[C@H](CC[C@H](C)OC(=O)/C=C/C(=O)[C@H](C)O)OCOC |
| InChI | InChI=1S/C15H24O6/c1-5-13(20-10-19-4)7-6-11(2)21-15(18)9-8-14(17)12(3)16/h5,8-9,11-13,16H,1,6-7,10H2,2-4H3/b9-8+/t11-,12-,13+/m0/s1 |
| InChIKey | FYSRRDGCJPDOJY-HFCZWNMXSA-N |
| XLogP | 1.38 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|