C17H8N2OS — CID 134842952
5-thia-9,19-diazapentacyclo[10.7.1.03,7.08,20.013,18]icosa-1(19),3,6,8,10,12(20),13,15,17-nonaen-2-one (PubChem CID 134842952) has the molecular formula C17H8N2OS and a molecular weight of 288.33 g/mol. Its IUPAC name is 5-thia-9,19-diazapentacyclo[10.7.1.03,7.08,20.013,18]icosa-1(19),3,6,8,10,12(20),13,15,17-nonaen-2-one.
| Compound Name | 5-thia-9,19-diazapentacyclo[10.7.1.03,7.08,20.013,18]icosa-1(19),3,6,8,10,12(20),13,15,17-nonaen-2-one |
|---|---|
| PubChem CID | 134842952 |
| Molecular Formula | C17H8N2OS |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 5-thia-9,19-diazapentacyclo[10.7.1.03,7.08,20.013,18]icosa-1(19),3,6,8,10,12(20),13,15,17-nonaen-2-one |
| SMILES | O=C1c2cscc2-c2nccc3c2c1nc1ccccc13 |
| InChI | InChI=1S/C17H8N2OS/c20-17-12-8-21-7-11(12)15-14-10(5-6-18-15)9-3-1-2-4-13(9)19-16(14)17/h1-8H |
| InChIKey | UKGUOODNYJIFBC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|