C49H53NO5Si — CID 134843171
N-benzyl-5-[tert-butyl(diphenyl)silyl]oxy-2,3,4-tris(phenylmethoxy)pentan-1-imine oxide (PubChem CID 134843171) has the molecular formula C49H53NO5Si and a molecular weight of 764.05 g/mol. Its IUPAC name is N-benzyl-5-[tert-butyl(diphenyl)silyl]oxy-2,3,4-tris(phenylmethoxy)pentan-1-imine oxide.
| Compound Name | N-benzyl-5-[tert-butyl(diphenyl)silyl]oxy-2,3,4-tris(phenylmethoxy)pentan-1-imine oxide |
|---|---|
| PubChem CID | 134843171 |
| Molecular Formula | C49H53NO5Si |
| Molecular Weight | 764.05 g/mol |
| Exact Mass | 763.37 |
| IUPAC Name | N-benzyl-5-[tert-butyl(diphenyl)silyl]oxy-2,3,4-tris(phenylmethoxy)pentan-1-imine oxide |
| SMILES | CC(C)(C)[Si](OCC(OCc1ccccc1)C(OCc1ccccc1)C(/C=[N+](\[O-])Cc1ccccc1)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C49H53NO5Si/c1-49(2,3)56(44-30-18-8-19-31-44,45-32-20-9-21-33-45)55-39-47(53-37-42-26-14-6-15-27-42)48(54-38-43-28-16-7-17-29-43)46(52-36-41-24-12-5-13-25-41)35-50(51)34-40-22-10-4-11-23-40/h4-33,35,46-48H,34,36-39H2,1-3H3/b50-35- |
| InChIKey | COZKIVPRNFWFLS-PCIFVOTLSA-N |
| XLogP | 9.10 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.05 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|