C22H22F3NO — CID 134843424
1-[[(1R)-1-naphthalen-1-ylethyl]amino]-3-[3-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 134843424) has the molecular formula C22H22F3NO and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-[[(1R)-1-naphthalen-1-ylethyl]amino]-3-[3-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | 1-[[(1R)-1-naphthalen-1-ylethyl]amino]-3-[3-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 134843424 |
| Molecular Formula | C22H22F3NO |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-[[(1R)-1-naphthalen-1-ylethyl]amino]-3-[3-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | C[C@@H](NCC(O)Cc1cccc(C(F)(F)F)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H22F3NO/c1-15(20-11-5-8-17-7-2-3-10-21(17)20)26-14-19(27)13-16-6-4-9-18(12-16)22(23,24)25/h2-12,15,19,26-27H,13-14H2,1H3/t15-,19?/m1/s1 |
| InChIKey | RKGMCBHMYFYWOB-NYRJJRHWSA-N |
| XLogP | 5.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |