C13H14O3 — CID 13484349
(1S,4R,8S,11R)-6-oxatetracyclo[9.2.1.02,10.04,8]tetradec-2(10)-ene-5,7-dione (PubChem CID 13484349) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (1S,4R,8S,11R)-6-oxatetracyclo[9.2.1.02,10.04,8]tetradec-2(10)-ene-5,7-dione.
| Compound Name | (1S,4R,8S,11R)-6-oxatetracyclo[9.2.1.02,10.04,8]tetradec-2(10)-ene-5,7-dione |
|---|---|
| PubChem CID | 13484349 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1S,4R,8S,11R)-6-oxatetracyclo[9.2.1.02,10.04,8]tetradec-2(10)-ene-5,7-dione |
| SMILES | O=C1OC(=O)[C@@H]2CC3=C(C[C@H]12)[C@@H]1CC[C@H]3C1 |
| InChI | InChI=1S/C13H14O3/c14-12-10-4-8-6-1-2-7(3-6)9(8)5-11(10)13(15)16-12/h6-7,10-11H,1-5H2/t6-,7+,10+,11- |
| InChIKey | SSOILFVSNPVOJF-FIPCFZRWSA-N |
| XLogP | 1.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|