C17H14N2O2S2 — CID 134843513
2-(7,7'-spirobi[4,5-dihydrothieno[2,3-c]pyran]-2'-yl)pyrimidine (PubChem CID 134843513) has the molecular formula C17H14N2O2S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-(7,7'-spirobi[4,5-dihydrothieno[2,3-c]pyran]-2'-yl)pyrimidine.
| Compound Name | 2-(7,7'-spirobi[4,5-dihydrothieno[2,3-c]pyran]-2'-yl)pyrimidine |
|---|---|
| PubChem CID | 134843513 |
| Molecular Formula | C17H14N2O2S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 2-(7,7'-spirobi[4,5-dihydrothieno[2,3-c]pyran]-2'-yl)pyrimidine |
| SMILES | c1cnc(-c2cc3c(s2)C2(OCCc4ccsc42)OCC3)nc1 |
| InChI | InChI=1S/C17H14N2O2S2/c1-5-18-16(19-6-1)13-10-12-3-8-21-17(15(12)23-13)14-11(2-7-20-17)4-9-22-14/h1,4-6,9-10H,2-3,7-8H2 |
| InChIKey | HHWJUKVSNGKDMR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |