C15H16O2 — CID 13484355
(1R,4R,9S,12S)-tetracyclo[10.2.1.02,11.04,9]pentadeca-2(11),6-diene-5,8-dione (PubChem CID 13484355) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (1R,4R,9S,12S)-tetracyclo[10.2.1.02,11.04,9]pentadeca-2(11),6-diene-5,8-dione.
| Compound Name | (1R,4R,9S,12S)-tetracyclo[10.2.1.02,11.04,9]pentadeca-2(11),6-diene-5,8-dione |
|---|---|
| PubChem CID | 13484355 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (1R,4R,9S,12S)-tetracyclo[10.2.1.02,11.04,9]pentadeca-2(11),6-diene-5,8-dione |
| SMILES | O=C1C=CC(=O)[C@@H]2CC3=C(C[C@H]12)[C@H]1CC[C@@H]3C1 |
| InChI | InChI=1S/C15H16O2/c16-14-3-4-15(17)13-7-11-9-2-1-8(5-9)10(11)6-12(13)14/h3-4,8-9,12-13H,1-2,5-7H2/t8-,9+,12-,13+ |
| InChIKey | DJOLFPKYQLMYJL-KGOITJQVSA-N |
| XLogP | 2.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|