About 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine
5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine (PubChem CID 134843583) has the molecular formula C8H10N4O2
and a molecular weight of 194.19 g/mol. Its IUPAC name is 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine.
Molecular Properties
| Compound Name | 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine |
| PubChem CID | 134843583 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine |
| SMILES | COC1(OC)N=C(N)c2nccnc21 |
| InChI | InChI=1S/C8H10N4O2/c1-13-8(14-2)6-5(7(9)12-8)10-3-4-11-6/h3-4H,1-2H3,(H2,9,12) |
| InChIKey | IOPQWUYCMXLKDE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine?
The IUPAC name of 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine (CID 134843583) is 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine.
What is the SMILES notation for 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine?
The canonical SMILES for 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine is COC1(OC)N=C(N)c2nccnc21.
What is the InChIKey of 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine?
The InChIKey is IOPQWUYCMXLKDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2/c1-13-8(14-2)6-5(7(9)12-8)10-3-4-11-6/h3-4H,1-2H3,(H2,9,12).
What are the key properties of 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine?
5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine has a molecular weight of 194.19 g/mol, XLogP of -0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethoxypyrrolo[3,4-b]pyrazin-7-amine is sourced from PubChem (CID 134843583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).