About (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one
(6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one (PubChem CID 134843669) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one |
| PubChem CID | 134843669 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one |
| SMILES | CC1(C)CC[C@H](/C=C2\C=CC=CC2=O)O1 |
| InChI | InChI=1S/C13H16O2/c1-13(2)8-7-11(15-13)9-10-5-3-4-6-12(10)14/h3-6,9,11H,7-8H2,1-2H3/b10-9+/t11-/m1/s1 |
| InChIKey | PICAZXLEEDCZNP-PBQZMEPESA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one?
The IUPAC name of (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one (CID 134843669) is (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one.
What is the SMILES notation for (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one?
The canonical SMILES for (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one is CC1(C)CC[C@H](/C=C2\C=CC=CC2=O)O1.
What is the InChIKey of (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one?
The InChIKey is PICAZXLEEDCZNP-PBQZMEPESA-N. The full InChI is InChI=1S/C13H16O2/c1-13(2)8-7-11(15-13)9-10-5-3-4-6-12(10)14/h3-6,9,11H,7-8H2,1-2H3/b10-9+/t11-/m1/s1.
What are the key properties of (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one?
(6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one has a molecular weight of 204.27 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-[[(2R)-5,5-dimethyloxolan-2-yl]methylidene]cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 134843669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).