About 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one
6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one (PubChem CID 134843680) has the molecular formula C21H26O
and a molecular weight of 294.44 g/mol. Its IUPAC name is 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one.
Molecular Properties
| Compound Name | 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one |
| PubChem CID | 134843680 |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one |
| SMILES | CC(C)=CCC1(CC=C(C)C)C(=O)C=Cc2cc(C)ccc21 |
| InChI | InChI=1S/C21H26O/c1-15(2)10-12-21(13-11-16(3)4)19-8-6-17(5)14-18(19)7-9-20(21)22/h6-11,14H,12-13H2,1-5H3 |
| InChIKey | DSBBWYWJXQCBDX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one?
The IUPAC name of 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one (CID 134843680) is 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one.
What is the SMILES notation for 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one?
The canonical SMILES for 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one is CC(C)=CCC1(CC=C(C)C)C(=O)C=Cc2cc(C)ccc21.
What is the InChIKey of 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one?
The InChIKey is DSBBWYWJXQCBDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O/c1-15(2)10-12-21(13-11-16(3)4)19-8-6-17(5)14-18(19)7-9-20(21)22/h6-11,14H,12-13H2,1-5H3.
What are the key properties of 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one?
6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one has a molecular weight of 294.44 g/mol, XLogP of 5.54, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,1-bis(3-methylbut-2-enyl)naphthalen-2-one is sourced from PubChem (CID 134843680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).