C31H43NOSi — CID 134843764
tert-butyl-[[(2S)-1-[(1E,3E)-4,5-dimethylhexa-1,3,5-trienyl]pyrrolidin-2-yl]-diphenylmethoxy]-dimethylsilane (PubChem CID 134843764) has the molecular formula C31H43NOSi and a molecular weight of 473.78 g/mol. Its IUPAC name is tert-butyl-[[(2S)-1-[(1E,3E)-4,5-dimethylhexa-1,3,5-trienyl]pyrrolidin-2-yl]-diphenylmethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S)-1-[(1E,3E)-4,5-dimethylhexa-1,3,5-trienyl]pyrrolidin-2-yl]-diphenylmethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134843764 |
| Molecular Formula | C31H43NOSi |
| Molecular Weight | 473.78 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | tert-butyl-[[(2S)-1-[(1E,3E)-4,5-dimethylhexa-1,3,5-trienyl]pyrrolidin-2-yl]-diphenylmethoxy]-dimethylsilane |
| SMILES | C=C(C)/C(C)=C/C=C/N1CCC[C@H]1C(O[Si](C)(C)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H43NOSi/c1-25(2)26(3)17-15-23-32-24-16-22-29(32)31(27-18-11-9-12-19-27,28-20-13-10-14-21-28)33-34(7,8)30(4,5)6/h9-15,17-21,23,29H,1,16,22,24H2,2-8H3/b23-15+,26-17+/t29-/m0/s1 |
| InChIKey | MUOVWKUPBCZXCZ-HLHNSDHYSA-N |
| XLogP | 8.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.78 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|