C18H14Br2O — CID 134843780
1,6-dibromo-2-[(4-methylphenyl)methoxy]naphthalene (PubChem CID 134843780) has the molecular formula C18H14Br2O and a molecular weight of 406.12 g/mol. Its IUPAC name is 1,6-dibromo-2-[(4-methylphenyl)methoxy]naphthalene.
| Compound Name | 1,6-dibromo-2-[(4-methylphenyl)methoxy]naphthalene |
|---|---|
| PubChem CID | 134843780 |
| Molecular Formula | C18H14Br2O |
| Molecular Weight | 406.12 g/mol |
| Exact Mass | 403.94 |
| IUPAC Name | 1,6-dibromo-2-[(4-methylphenyl)methoxy]naphthalene |
| SMILES | Cc1ccc(COc2ccc3cc(Br)ccc3c2Br)cc1 |
| InChI | InChI=1S/C18H14Br2O/c1-12-2-4-13(5-3-12)11-21-17-9-6-14-10-15(19)7-8-16(14)18(17)20/h2-10H,11H2,1H3 |
| InChIKey | OUKVHKCWBABQPD-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.12 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |