About methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate
methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate (PubChem CID 134843912) has the molecular formula C20H23NO4
and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate |
| PubChem CID | 134843912 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate |
| SMILES | COC(=O)C1C(C(C)=O)=C(C)N(c2ccc(C)cc2)C(C)=C1C(C)=O |
| InChI | InChI=1S/C20H23NO4/c1-11-7-9-16(10-8-11)21-12(2)17(14(4)22)19(20(24)25-6)18(13(21)3)15(5)23/h7-10,19H,1-6H3 |
| InChIKey | GBTMKZHJRFEVRD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate?
The IUPAC name of methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate (CID 134843912) is methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate.
What is the SMILES notation for methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate?
The canonical SMILES for methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate is COC(=O)C1C(C(C)=O)=C(C)N(c2ccc(C)cc2)C(C)=C1C(C)=O.
What is the InChIKey of methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate?
The InChIKey is GBTMKZHJRFEVRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO4/c1-11-7-9-16(10-8-11)21-12(2)17(14(4)22)19(20(24)25-6)18(13(21)3)15(5)23/h7-10,19H,1-6H3.
What are the key properties of methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate?
methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate has a molecular weight of 341.41 g/mol, XLogP of 3.33, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-diacetyl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-4-carboxylate is sourced from PubChem (CID 134843912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).