About 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline
3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline (PubChem CID 134843933) has the molecular formula C19H13F3N4
and a molecular weight of 354.34 g/mol. Its IUPAC name is 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline.
Molecular Properties
| Compound Name | 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline |
| PubChem CID | 134843933 |
| Molecular Formula | C19H13F3N4 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline |
| SMILES | FC(F)(F)Cc1c(-c2ccccc2)nnn1-c1cnc2ccccc2c1 |
| InChI | InChI=1S/C19H13F3N4/c20-19(21,22)11-17-18(13-6-2-1-3-7-13)24-25-26(17)15-10-14-8-4-5-9-16(14)23-12-15/h1-10,12H,11H2 |
| InChIKey | NAXRDOPLPYZJLR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline?
The IUPAC name of 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline (CID 134843933) is 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline.
What is the SMILES notation for 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline?
The canonical SMILES for 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline is FC(F)(F)Cc1c(-c2ccccc2)nnn1-c1cnc2ccccc2c1.
What is the InChIKey of 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline?
The InChIKey is NAXRDOPLPYZJLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F3N4/c20-19(21,22)11-17-18(13-6-2-1-3-7-13)24-25-26(17)15-10-14-8-4-5-9-16(14)23-12-15/h1-10,12H,11H2.
What are the key properties of 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline?
3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline has a molecular weight of 354.34 g/mol, XLogP of 4.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-phenyl-5-(2,2,2-trifluoroethyl)triazol-1-yl]quinoline is sourced from PubChem (CID 134843933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).