C20H34O4Si — CID 134843981
2-trimethylsilylethyl (4aR)-2,2,6,6-tetramethyl-5-methylidene-4-oxo-3,7,8,8a-tetrahydrochromene-4a-carboxylate (PubChem CID 134843981) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is 2-trimethylsilylethyl (4aR)-2,2,6,6-tetramethyl-5-methylidene-4-oxo-3,7,8,8a-tetrahydrochromene-4a-carboxylate.
| Compound Name | 2-trimethylsilylethyl (4aR)-2,2,6,6-tetramethyl-5-methylidene-4-oxo-3,7,8,8a-tetrahydrochromene-4a-carboxylate |
|---|---|
| PubChem CID | 134843981 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-trimethylsilylethyl (4aR)-2,2,6,6-tetramethyl-5-methylidene-4-oxo-3,7,8,8a-tetrahydrochromene-4a-carboxylate |
| SMILES | C=C1C(C)(C)CCC2OC(C)(C)CC(=O)[C@@]12C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C20H34O4Si/c1-14-18(2,3)10-9-16-20(14,15(21)13-19(4,5)24-16)17(22)23-11-12-25(6,7)8/h16H,1,9-13H2,2-8H3/t16?,20-/m0/s1 |
| InChIKey | DJUZROCDXOCFBH-FZCLLLDFSA-N |
| XLogP | 4.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|