C46H44N12 — CID 134843995
1-methyl-4-[4-[3,5,7-tris[4-(3-methyltriazol-4-yl)phenyl]-1-adamantyl]phenyl]triazole (PubChem CID 134843995) has the molecular formula C46H44N12 and a molecular weight of 764.94 g/mol. Its IUPAC name is 1-methyl-4-[4-[3,5,7-tris[4-(3-methyltriazol-4-yl)phenyl]-1-adamantyl]phenyl]triazole.
| Compound Name | 1-methyl-4-[4-[3,5,7-tris[4-(3-methyltriazol-4-yl)phenyl]-1-adamantyl]phenyl]triazole |
|---|---|
| PubChem CID | 134843995 |
| Molecular Formula | C46H44N12 |
| Molecular Weight | 764.94 g/mol |
| Exact Mass | 764.38 |
| IUPAC Name | 1-methyl-4-[4-[3,5,7-tris[4-(3-methyltriazol-4-yl)phenyl]-1-adamantyl]phenyl]triazole |
| SMILES | Cn1cc(-c2ccc(C34CC5(c6ccc(-c7cnnn7C)cc6)CC(c6ccc(-c7cnnn7C)cc6)(C3)CC(c3ccc(-c6cnnn6C)cc3)(C4)C5)cc2)nn1 |
| InChI | InChI=1S/C46H44N12/c1-55-24-39(50-54-55)31-5-13-35(14-6-31)43-25-44(36-15-7-32(8-16-36)40-21-47-51-56(40)2)28-45(26-43,37-17-9-33(10-18-37)41-22-48-52-57(41)3)30-46(27-43,29-44)38-19-11-34(12-20-38)42-23-49-53-58(42)4/h5-24H,25-30H2,1-4H3 |
| InChIKey | CHVIHSPDRSAGJF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 122.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.94 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |