C28H48O7Si2 — CID 134844153
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5,7-dihydroxy-10-methyl-7-[(3S)-3-triethylsilyloxybutyl]-8,12-dioxatricyclo[7.4.0.02,6]trideca-1(9),5,10-trien-13-one (PubChem CID 134844153) has the molecular formula C28H48O7Si2 and a molecular weight of 552.86 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5,7-dihydroxy-10-methyl-7-[(3S)-3-triethylsilyloxybutyl]-8,12-dioxatricyclo[7.4.0.02,6]trideca-1(9),5,10-trien-13-one.
| Compound Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5,7-dihydroxy-10-methyl-7-[(3S)-3-triethylsilyloxybutyl]-8,12-dioxatricyclo[7.4.0.02,6]trideca-1(9),5,10-trien-13-one |
|---|---|
| PubChem CID | 134844153 |
| Molecular Formula | C28H48O7Si2 |
| Molecular Weight | 552.86 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5,7-dihydroxy-10-methyl-7-[(3S)-3-triethylsilyloxybutyl]-8,12-dioxatricyclo[7.4.0.02,6]trideca-1(9),5,10-trien-13-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](C)CCC1(O)Oc2c(C)coc(=O)c2[C@H]2C1=C(O)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H48O7Si2/c1-11-37(12-2,13-3)34-19(5)14-15-28(31)24-20(29)16-21(35-36(9,10)27(6,7)8)22(24)23-25(33-28)18(4)17-32-26(23)30/h17,19,21-22,29,31H,11-16H2,1-10H3/t19-,21-,22-,28?/m0/s1 |
| InChIKey | KHXKFACDRYOHIS-JQFWXEGGSA-N |
| XLogP | 6.91 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.86 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|