C17H32O4 — CID 134844232
(2S,3S,4S)-4-[(4S,5R,6S)-6-[(2S)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-2-methylpentane-1,3-diol (PubChem CID 134844232) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is (2S,3S,4S)-4-[(4S,5R,6S)-6-[(2S)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-2-methylpentane-1,3-diol.
| Compound Name | (2S,3S,4S)-4-[(4S,5R,6S)-6-[(2S)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-2-methylpentane-1,3-diol |
|---|---|
| PubChem CID | 134844232 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | (2S,3S,4S)-4-[(4S,5R,6S)-6-[(2S)-but-3-en-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-2-methylpentane-1,3-diol |
| SMILES | C=C[C@H](C)[C@@H]1OC(C)(C)O[C@@H]([C@@H](C)[C@@H](O)[C@@H](C)CO)[C@@H]1C |
| InChI | InChI=1S/C17H32O4/c1-8-10(2)15-13(5)16(21-17(6,7)20-15)12(4)14(19)11(3)9-18/h8,10-16,18-19H,1,9H2,2-7H3/t10-,11-,12-,13+,14-,15-,16-/m0/s1 |
| InChIKey | UJRNFYNGCMCSJX-XXXYLRJTSA-N |
| XLogP | 2.59 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|