C10H17NO — CID 134844242
(8aR)-2-methyl-1,3,4,4a,5,6,8,8a-octahydroisoquinolin-7-one (PubChem CID 134844242) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (8aR)-2-methyl-1,3,4,4a,5,6,8,8a-octahydroisoquinolin-7-one.
| Compound Name | (8aR)-2-methyl-1,3,4,4a,5,6,8,8a-octahydroisoquinolin-7-one |
|---|---|
| PubChem CID | 134844242 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (8aR)-2-methyl-1,3,4,4a,5,6,8,8a-octahydroisoquinolin-7-one |
| SMILES | CN1CCC2CCC(=O)C[C@H]2C1 |
| InChI | InChI=1S/C10H17NO/c1-11-5-4-8-2-3-10(12)6-9(8)7-11/h8-9H,2-7H2,1H3/t8?,9-/m0/s1 |
| InChIKey | HDCHKSIHNBHDIQ-GKAPJAKFSA-N |
| XLogP | 1.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |