C30H35NOP+ — CID 134844284
[(4E,6E)-8-(2-methylpropylamino)-8-oxoocta-4,6-dienyl]-triphenylphosphanium (PubChem CID 134844284) has the molecular formula C30H35NOP+ and a molecular weight of 456.59 g/mol. Its IUPAC name is [(4E,6E)-8-(2-methylpropylamino)-8-oxoocta-4,6-dienyl]-triphenylphosphanium.
| Compound Name | [(4E,6E)-8-(2-methylpropylamino)-8-oxoocta-4,6-dienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 134844284 |
| Molecular Formula | C30H35NOP+ |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | [(4E,6E)-8-(2-methylpropylamino)-8-oxoocta-4,6-dienyl]-triphenylphosphanium |
| SMILES | CC(C)CNC(=O)/C=C/C=C/CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H34NOP/c1-26(2)25-31-30(32)23-15-4-3-5-16-24-33(27-17-9-6-10-18-27,28-19-11-7-12-20-28)29-21-13-8-14-22-29/h3-4,6-15,17-23,26H,5,16,24-25H2,1-2H3/p+1/b4-3+,23-15+ |
| InChIKey | IGUCZOZJFUAGEV-MHYSQHLISA-O |
| XLogP | 5.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|