C15H12Cl3N5O2 — CID 134844616
1-[(1Z)-1-[(1R,5S)-3-azabicyclo[3.1.0]hexan-3-yl]-3,4,4-trichloro-2-nitrobuta-1,3-dienyl]benzotriazole (PubChem CID 134844616) has the molecular formula C15H12Cl3N5O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is 1-[(1Z)-1-[(1R,5S)-3-azabicyclo[3.1.0]hexan-3-yl]-3,4,4-trichloro-2-nitrobuta-1,3-dienyl]benzotriazole.
| Compound Name | 1-[(1Z)-1-[(1R,5S)-3-azabicyclo[3.1.0]hexan-3-yl]-3,4,4-trichloro-2-nitrobuta-1,3-dienyl]benzotriazole |
|---|---|
| PubChem CID | 134844616 |
| Molecular Formula | C15H12Cl3N5O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 1-[(1Z)-1-[(1R,5S)-3-azabicyclo[3.1.0]hexan-3-yl]-3,4,4-trichloro-2-nitrobuta-1,3-dienyl]benzotriazole |
| SMILES | O=[N+]([O-])/C(C(Cl)=C(Cl)Cl)=C(/N1C[C@H]2C[C@H]2C1)n1nnc2ccccc21 |
| InChI | InChI=1S/C15H12Cl3N5O2/c16-12(14(17)18)13(23(24)25)15(21-6-8-5-9(8)7-21)22-11-4-2-1-3-10(11)19-20-22/h1-4,8-9H,5-7H2/b15-13-/t8-,9+ |
| InChIKey | ITJNQVCJEYIHJU-ZECSFZNESA-N |
| XLogP | 3.67 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|