C16H32O5 — CID 134844663
(2S,3S,4S,5S,6S)-6-[(2S,3S)-6-methoxy-3-methyloxan-2-yl]-2,4-dimethylheptane-1,3,5-triol (PubChem CID 134844663) has the molecular formula C16H32O5 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-6-[(2S,3S)-6-methoxy-3-methyloxan-2-yl]-2,4-dimethylheptane-1,3,5-triol.
| Compound Name | (2S,3S,4S,5S,6S)-6-[(2S,3S)-6-methoxy-3-methyloxan-2-yl]-2,4-dimethylheptane-1,3,5-triol |
|---|---|
| PubChem CID | 134844663 |
| Molecular Formula | C16H32O5 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (2S,3S,4S,5S,6S)-6-[(2S,3S)-6-methoxy-3-methyloxan-2-yl]-2,4-dimethylheptane-1,3,5-triol |
| SMILES | COC1CC[C@H](C)[C@@H]([C@@H](C)[C@@H](O)[C@@H](C)[C@@H](O)[C@@H](C)CO)O1 |
| InChI | InChI=1S/C16H32O5/c1-9-6-7-13(20-5)21-16(9)12(4)15(19)11(3)14(18)10(2)8-17/h9-19H,6-8H2,1-5H3/t9-,10-,11-,12-,13?,14-,15-,16-/m0/s1 |
| InChIKey | KSOYCORXTLJHQH-JBGWIMBUSA-N |
| XLogP | 1.40 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |