C22H17N3O3 — CID 134844775
3-(5-nitroindazol-1-yl)-1,3-diphenylpropan-1-one (PubChem CID 134844775) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is 3-(5-nitroindazol-1-yl)-1,3-diphenylpropan-1-one.
| Compound Name | 3-(5-nitroindazol-1-yl)-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 134844775 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 3-(5-nitroindazol-1-yl)-1,3-diphenylpropan-1-one |
| SMILES | O=C(CC(c1ccccc1)n1ncc2cc([N+](=O)[O-])ccc21)c1ccccc1 |
| InChI | InChI=1S/C22H17N3O3/c26-22(17-9-5-2-6-10-17)14-21(16-7-3-1-4-8-16)24-20-12-11-19(25(27)28)13-18(20)15-23-24/h1-13,15,21H,14H2 |
| InChIKey | YKNORAXROZTPPE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|