C16H20O3 — CID 134844840
(4Z,7Z,10S)-5,9,9,10-tetramethyl-11-oxabicyclo[8.2.1]trideca-1(13),4,7-triene-6,12-dione (PubChem CID 134844840) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (4Z,7Z,10S)-5,9,9,10-tetramethyl-11-oxabicyclo[8.2.1]trideca-1(13),4,7-triene-6,12-dione.
| Compound Name | (4Z,7Z,10S)-5,9,9,10-tetramethyl-11-oxabicyclo[8.2.1]trideca-1(13),4,7-triene-6,12-dione |
|---|---|
| PubChem CID | 134844840 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (4Z,7Z,10S)-5,9,9,10-tetramethyl-11-oxabicyclo[8.2.1]trideca-1(13),4,7-triene-6,12-dione |
| SMILES | C/C1=C/CCC2=C[C@](C)(OC2=O)C(C)(C)/C=C\C1=O |
| InChI | InChI=1S/C16H20O3/c1-11-6-5-7-12-10-16(4,19-14(12)18)15(2,3)9-8-13(11)17/h6,8-10H,5,7H2,1-4H3/b9-8-,11-6-/t16-/m0/s1 |
| InChIKey | DWRONLSJGSINNF-IPIGKQOJSA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |