C19H27NO2 — CID 134844849
ethyl (3S,4aR,7aR)-1-benzyl-3-methyl-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridine-4a-carboxylate (PubChem CID 134844849) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is ethyl (3S,4aR,7aR)-1-benzyl-3-methyl-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridine-4a-carboxylate.
| Compound Name | ethyl (3S,4aR,7aR)-1-benzyl-3-methyl-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 134844849 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | ethyl (3S,4aR,7aR)-1-benzyl-3-methyl-3,4,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridine-4a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCC[C@H]1N(Cc1ccccc1)C[C@@H](C)C2 |
| InChI | InChI=1S/C19H27NO2/c1-3-22-18(21)19-11-7-10-17(19)20(13-15(2)12-19)14-16-8-5-4-6-9-16/h4-6,8-9,15,17H,3,7,10-14H2,1-2H3/t15-,17+,19+/m0/s1 |
| InChIKey | RFUYOWXTAOKALI-KVSKMBFKSA-N |
| XLogP | 3.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |