About [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol
[(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol (PubChem CID 134844923) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol |
| PubChem CID | 134844923 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol |
| SMILES | CC1=CC[C@@H](CO)O1 |
| InChI | InChI=1S/C6H10O2/c1-5-2-3-6(4-7)8-5/h2,6-7H,3-4H2,1H3/t6-/m0/s1 |
| InChIKey | GKBOCXDRSYRPLO-LURJTMIESA-N |
| XLogP | 0.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol?
The IUPAC name of [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol (CID 134844923) is [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol.
What is the SMILES notation for [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol?
The canonical SMILES for [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol is CC1=CC[C@@H](CO)O1.
What is the InChIKey of [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol?
The InChIKey is GKBOCXDRSYRPLO-LURJTMIESA-N. The full InChI is InChI=1S/C6H10O2/c1-5-2-3-6(4-7)8-5/h2,6-7H,3-4H2,1H3/t6-/m0/s1.
What are the key properties of [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol?
[(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol has a molecular weight of 114.14 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-5-methyl-2,3-dihydrofuran-2-yl]methanol is sourced from PubChem (CID 134844923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).