C22H50Si4 — CID 13484494
triethyl-[3-triethylsilyl-1,4-bis(trimethylsilyl)buta-1,2-dienyl]silane (PubChem CID 13484494) has the molecular formula C22H50Si4 and a molecular weight of 426.99 g/mol. Its IUPAC name is triethyl-[3-triethylsilyl-1,4-bis(trimethylsilyl)buta-1,2-dienyl]silane.
| Compound Name | triethyl-[3-triethylsilyl-1,4-bis(trimethylsilyl)buta-1,2-dienyl]silane |
|---|---|
| PubChem CID | 13484494 |
| Molecular Formula | C22H50Si4 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | triethyl-[3-triethylsilyl-1,4-bis(trimethylsilyl)buta-1,2-dienyl]silane |
| SMILES | CC[Si](CC)(CC)C(=C=C([Si](C)(C)C)[Si](CC)(CC)CC)C[Si](C)(C)C |
| InChI | InChI=1S/C22H50Si4/c1-13-25(14-2,15-3)21(20-23(7,8)9)19-22(24(10,11)12)26(16-4,17-5)18-6/h13-18,20H2,1-12H3 |
| InChIKey | RMHITBJKJYPSCR-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|