C16H24O8S — CID 134844998
[(2R,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4-trihydroxybutyl] 4-methylbenzenesulfonate (PubChem CID 134844998) has the molecular formula C16H24O8S and a molecular weight of 376.43 g/mol. Its IUPAC name is [(2R,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4-trihydroxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4-trihydroxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134844998 |
| Molecular Formula | C16H24O8S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [(2R,3R,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4-trihydroxybutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C16H24O8S/c1-10-4-6-11(7-5-10)25(20,21)23-8-12(17)14(18)15(19)13-9-22-16(2,3)24-13/h4-7,12-15,17-19H,8-9H2,1-3H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | POIXXRKVUWUEKJ-KBUPBQIOSA-N |
| XLogP | -0.07 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|