C13H20O4Si — CID 134845125
(5S,6R)-6-methoxy-8-trimethylsilyloxy-1-oxaspiro[4.5]deca-3,7-dien-2-one (PubChem CID 134845125) has the molecular formula C13H20O4Si and a molecular weight of 268.38 g/mol. Its IUPAC name is (5S,6R)-6-methoxy-8-trimethylsilyloxy-1-oxaspiro[4.5]deca-3,7-dien-2-one.
| Compound Name | (5S,6R)-6-methoxy-8-trimethylsilyloxy-1-oxaspiro[4.5]deca-3,7-dien-2-one |
|---|---|
| PubChem CID | 134845125 |
| Molecular Formula | C13H20O4Si |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (5S,6R)-6-methoxy-8-trimethylsilyloxy-1-oxaspiro[4.5]deca-3,7-dien-2-one |
| SMILES | CO[C@@H]1C=C(O[Si](C)(C)C)CC[C@]12C=CC(=O)O2 |
| InChI | InChI=1S/C13H20O4Si/c1-15-11-9-10(17-18(2,3)4)5-7-13(11)8-6-12(14)16-13/h6,8-9,11H,5,7H2,1-4H3/t11-,13+/m1/s1 |
| InChIKey | LSWNRYXCPIOZPV-YPMHNXCESA-N |
| XLogP | 2.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|