About (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one
(3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one (PubChem CID 134845135) has the molecular formula C10H16O6
and a molecular weight of 232.23 g/mol. Its IUPAC name is (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one.
Molecular Properties
| Compound Name | (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one |
| PubChem CID | 134845135 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one |
| SMILES | COCO[C@H]1CCCC12OC(=O)[C@@H](O)C2O |
| InChI | InChI=1S/C10H16O6/c1-14-5-15-6-3-2-4-10(6)8(12)7(11)9(13)16-10/h6-8,11-12H,2-5H2,1H3/t6-,7-,8?,10?/m0/s1 |
| InChIKey | FZLKBFYKTDYKNQ-KEMUHUQJSA-N |
| XLogP | -0.82 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one?
The IUPAC name of (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one (CID 134845135) is (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one.
What is the SMILES notation for (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one?
The canonical SMILES for (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one is COCO[C@H]1CCCC12OC(=O)[C@@H](O)C2O.
What is the InChIKey of (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one?
The InChIKey is FZLKBFYKTDYKNQ-KEMUHUQJSA-N. The full InChI is InChI=1S/C10H16O6/c1-14-5-15-6-3-2-4-10(6)8(12)7(11)9(13)16-10/h6-8,11-12H,2-5H2,1H3/t6-,7-,8?,10?/m0/s1.
What are the key properties of (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one?
(3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one has a molecular weight of 232.23 g/mol, XLogP of -0.82, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,9S)-3,4-dihydroxy-9-(methoxymethoxy)-1-oxaspiro[4.4]nonan-2-one is sourced from PubChem (CID 134845135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).