About 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile
5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile (PubChem CID 13484528) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile.
Molecular Properties
| Compound Name | 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile |
| PubChem CID | 13484528 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile |
| SMILES | CCCCC1=C(C#N)C(C#N)CN1 |
| InChI | InChI=1S/C10H13N3/c1-2-3-4-10-9(6-12)8(5-11)7-13-10/h8,13H,2-4,7H2,1H3 |
| InChIKey | GMLVRJUZDUNZLP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile?
The IUPAC name of 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile (CID 13484528) is 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile.
What is the SMILES notation for 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile?
The canonical SMILES for 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile is CCCCC1=C(C#N)C(C#N)CN1.
What is the InChIKey of 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile?
The InChIKey is GMLVRJUZDUNZLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-2-3-4-10-9(6-12)8(5-11)7-13-10/h8,13H,2-4,7H2,1H3.
What are the key properties of 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile?
5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile has a molecular weight of 175.23 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2,3-dihydro-1H-pyrrole-3,4-dicarbonitrile is sourced from PubChem (CID 13484528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).