About 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one
1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one (PubChem CID 134845408) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one.
Molecular Properties
| Compound Name | 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one |
| PubChem CID | 134845408 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one |
| SMILES | CN1CCCC12C=CC=CC2=O |
| InChI | InChI=1S/C10H13NO/c1-11-8-4-7-10(11)6-3-2-5-9(10)12/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | BJRXBGSVWBAXIK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one?
The IUPAC name of 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one (CID 134845408) is 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one.
What is the SMILES notation for 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one?
The canonical SMILES for 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one is CN1CCCC12C=CC=CC2=O.
What is the InChIKey of 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one?
The InChIKey is BJRXBGSVWBAXIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-11-8-4-7-10(11)6-3-2-5-9(10)12/h2-3,5-6H,4,7-8H2,1H3.
What are the key properties of 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one?
1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one has a molecular weight of 163.22 g/mol, XLogP of 1.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-azaspiro[4.5]deca-7,9-dien-6-one is sourced from PubChem (CID 134845408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).