C25H23NO3 — CID 134845464
(1S,2R,3R,8R,12R)-5,8-diphenyl-15-oxa-5-azatetracyclo[10.2.1.02,10.03,7]pentadec-9-ene-4,6-dione (PubChem CID 134845464) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is (1S,2R,3R,8R,12R)-5,8-diphenyl-15-oxa-5-azatetracyclo[10.2.1.02,10.03,7]pentadec-9-ene-4,6-dione.
| Compound Name | (1S,2R,3R,8R,12R)-5,8-diphenyl-15-oxa-5-azatetracyclo[10.2.1.02,10.03,7]pentadec-9-ene-4,6-dione |
|---|---|
| PubChem CID | 134845464 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (1S,2R,3R,8R,12R)-5,8-diphenyl-15-oxa-5-azatetracyclo[10.2.1.02,10.03,7]pentadec-9-ene-4,6-dione |
| SMILES | O=C1C2[C@H](c3ccccc3)C=C3C[C@H]4CC[C@H](O4)[C@@H]3[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C25H23NO3/c27-24-22-19(15-7-3-1-4-8-15)14-16-13-18-11-12-20(29-18)21(16)23(22)25(28)26(24)17-9-5-2-6-10-17/h1-10,14,18-23H,11-13H2/t18-,19+,20+,21-,22?,23-/m1/s1 |
| InChIKey | ZHAHXBGKXOCTNH-UZUSKLKSSA-N |
| XLogP | 4.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|