C26H30FN3O6 — CID 134845670
4-(2-fluoro-5-nitrobenzoyl)-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-1-oxa-4-azaspiro[4.5]decane-3-carboxamide (PubChem CID 134845670) has the molecular formula C26H30FN3O6 and a molecular weight of 499.54 g/mol. Its IUPAC name is 4-(2-fluoro-5-nitrobenzoyl)-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-1-oxa-4-azaspiro[4.5]decane-3-carboxamide.
| Compound Name | 4-(2-fluoro-5-nitrobenzoyl)-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-1-oxa-4-azaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 134845670 |
| Molecular Formula | C26H30FN3O6 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 4-(2-fluoro-5-nitrobenzoyl)-N-[(4-methoxyphenyl)methyl]-2,2-dimethyl-1-oxa-4-azaspiro[4.5]decane-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)C2N(C(=O)c3cc([N+](=O)[O-])ccc3F)C3(CCCCC3)OC2(C)C)cc1 |
| InChI | InChI=1S/C26H30FN3O6/c1-25(2)22(23(31)28-16-17-7-10-19(35-3)11-8-17)29(26(36-25)13-5-4-6-14-26)24(32)20-15-18(30(33)34)9-12-21(20)27/h7-12,15,22H,4-6,13-14,16H2,1-3H3,(H,28,31) |
| InChIKey | QYHMFDMNKZLXBG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|