C20H25N3O5 — CID 134845722
(3R)-5-azido-3,4-bis(phenylmethoxy)hexane-1,2,6-triol (PubChem CID 134845722) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is (3R)-5-azido-3,4-bis(phenylmethoxy)hexane-1,2,6-triol.
| Compound Name | (3R)-5-azido-3,4-bis(phenylmethoxy)hexane-1,2,6-triol |
|---|---|
| PubChem CID | 134845722 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (3R)-5-azido-3,4-bis(phenylmethoxy)hexane-1,2,6-triol |
| SMILES | [N-]=[N+]=NC(CO)C(OCc1ccccc1)[C@H](OCc1ccccc1)C(O)CO |
| InChI | InChI=1S/C20H25N3O5/c21-23-22-17(11-24)19(27-13-15-7-3-1-4-8-15)20(18(26)12-25)28-14-16-9-5-2-6-10-16/h1-10,17-20,24-26H,11-14H2/t17?,18?,19?,20-/m1/s1 |
| InChIKey | YRCFJYGZXVMFFB-YSFGRKDWSA-N |
| XLogP | 2.18 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|