C22H45NO2SSi — CID 134845804
(R)-N-[(1R,2S,3S)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenylcyclohexyl]-2-methylpropane-2-sulfinamide (PubChem CID 134845804) has the molecular formula C22H45NO2SSi and a molecular weight of 415.76 g/mol. Its IUPAC name is (R)-N-[(1R,2S,3S)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenylcyclohexyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1R,2S,3S)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenylcyclohexyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134845804 |
| Molecular Formula | C22H45NO2SSi |
| Molecular Weight | 415.76 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | (R)-N-[(1R,2S,3S)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxy-1-ethenylcyclohexyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=C[C@]1(N[S@](=O)C(C)(C)C)CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1CCCC |
| InChI | InChI=1S/C22H45NO2SSi/c1-11-13-15-18-19(25-27(9,10)21(6,7)8)16-14-17-22(18,12-2)23-26(24)20(3,4)5/h12,18-19,23H,2,11,13-17H2,1,3-10H3/t18-,19+,22+,26-/m1/s1 |
| InChIKey | UNLFJRGIAIOGPR-BFFCPOFVSA-N |
| XLogP | 6.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.76 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|