C26H29N3O4 — CID 134845818
(2R,3S,4S)-4-azido-2,3,5-tris(phenylmethoxy)pentan-1-ol (PubChem CID 134845818) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is (2R,3S,4S)-4-azido-2,3,5-tris(phenylmethoxy)pentan-1-ol.
| Compound Name | (2R,3S,4S)-4-azido-2,3,5-tris(phenylmethoxy)pentan-1-ol |
|---|---|
| PubChem CID | 134845818 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | (2R,3S,4S)-4-azido-2,3,5-tris(phenylmethoxy)pentan-1-ol |
| SMILES | [N-]=[N+]=N[C@@H](COCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](CO)OCc1ccccc1 |
| InChI | InChI=1S/C26H29N3O4/c27-29-28-24(20-31-17-21-10-4-1-5-11-21)26(33-19-23-14-8-3-9-15-23)25(16-30)32-18-22-12-6-2-7-13-22/h1-15,24-26,30H,16-20H2/t24-,25+,26-/m0/s1 |
| InChIKey | JKCNUICFWRPCOJ-NXCFDTQHSA-N |
| XLogP | 5.05 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|