C17H30N2 — CID 134845839
(1S,2S,10S,11R,13S,15R)-6,15-dimethyl-6,12-diazatetracyclo[9.5.1.02,10.02,13]heptadecane (PubChem CID 134845839) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is (1S,2S,10S,11R,13S,15R)-6,15-dimethyl-6,12-diazatetracyclo[9.5.1.02,10.02,13]heptadecane.
| Compound Name | (1S,2S,10S,11R,13S,15R)-6,15-dimethyl-6,12-diazatetracyclo[9.5.1.02,10.02,13]heptadecane |
|---|---|
| PubChem CID | 134845839 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | (1S,2S,10S,11R,13S,15R)-6,15-dimethyl-6,12-diazatetracyclo[9.5.1.02,10.02,13]heptadecane |
| SMILES | C[C@@H]1C[C@H]2C[C@H]3N[C@@H](C1)[C@@]21CCCN(C)CCC[C@H]31 |
| InChI | InChI=1S/C17H30N2/c1-12-9-13-11-15-14-5-3-7-19(2)8-4-6-17(13,14)16(10-12)18-15/h12-16,18H,3-11H2,1-2H3/t12-,13+,14-,15-,16+,17+/m1/s1 |
| InChIKey | DJAJVKXYHMDFRT-NEMWNAMBSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |