C16H24O — CID 134846056
(1S,3R,6S,8S,11R)-2-methoxy-5,7,7,11-tetramethyltetracyclo[6.3.0.01,3.02,6]undec-4-ene (PubChem CID 134846056) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (1S,3R,6S,8S,11R)-2-methoxy-5,7,7,11-tetramethyltetracyclo[6.3.0.01,3.02,6]undec-4-ene.
| Compound Name | (1S,3R,6S,8S,11R)-2-methoxy-5,7,7,11-tetramethyltetracyclo[6.3.0.01,3.02,6]undec-4-ene |
|---|---|
| PubChem CID | 134846056 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (1S,3R,6S,8S,11R)-2-methoxy-5,7,7,11-tetramethyltetracyclo[6.3.0.01,3.02,6]undec-4-ene |
| SMILES | COC12[C@H]3C(C)=C[C@@H]1[C@@]21[C@H](C)CC[C@H]1C3(C)C |
| InChI | InChI=1S/C16H24O/c1-9-8-12-15-10(2)6-7-11(15)14(3,4)13(9)16(12,15)17-5/h8,10-13H,6-7H2,1-5H3/t10-,11+,12-,13+,15+,16?/m1/s1 |
| InChIKey | AQVASXCZVLANSQ-CBFDPXPGSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|