About CID 134846215
CID 134846215 (PubChem CID 134846215) has the molecular formula C15H12F3IO3S
and a molecular weight of 456.22 g/mol.
Molecular Properties
| Compound Name | CID 134846215 |
| PubChem CID | 134846215 |
| Molecular Formula | C15H12F3IO3S |
| Molecular Weight | 456.22 g/mol |
| Exact Mass | 455.95 |
| IUPAC Name | — |
| SMILES | [CH]I([CH])(OS(=O)(=O)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12F3IO3S/c1-19(2,13-9-5-3-6-10-13,14-11-7-4-8-12-14)22-23(20,21)15(16,17)18/h1-12H |
| InChIKey | FRCYQLJAPKMARL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.22 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze CID 134846215 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134846215?
The IUPAC name of CID 134846215 (CID 134846215) is not available.
What is the SMILES notation for CID 134846215?
The canonical SMILES for CID 134846215 is [CH]I([CH])(OS(=O)(=O)C(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 134846215?
The InChIKey is FRCYQLJAPKMARL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F3IO3S/c1-19(2,13-9-5-3-6-10-13,14-11-7-4-8-12-14)22-23(20,21)15(16,17)18/h1-12H.
What are the key properties of CID 134846215?
CID 134846215 has a molecular weight of 456.22 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134846215 is sourced from PubChem (CID 134846215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).