C29H44O6Si — CID 134846265
(2R,4R,5S,6R,7S,8S)-1-[tert-butyl(diphenyl)silyl]oxy-5,7,9-trihydroxy-4-methoxy-2,6,8-trimethylnonan-3-one (PubChem CID 134846265) has the molecular formula C29H44O6Si and a molecular weight of 516.75 g/mol. Its IUPAC name is (2R,4R,5S,6R,7S,8S)-1-[tert-butyl(diphenyl)silyl]oxy-5,7,9-trihydroxy-4-methoxy-2,6,8-trimethylnonan-3-one.
| Compound Name | (2R,4R,5S,6R,7S,8S)-1-[tert-butyl(diphenyl)silyl]oxy-5,7,9-trihydroxy-4-methoxy-2,6,8-trimethylnonan-3-one |
|---|---|
| PubChem CID | 134846265 |
| Molecular Formula | C29H44O6Si |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | (2R,4R,5S,6R,7S,8S)-1-[tert-butyl(diphenyl)silyl]oxy-5,7,9-trihydroxy-4-methoxy-2,6,8-trimethylnonan-3-one |
| SMILES | CO[C@@H](C(=O)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](O)[C@H](C)[C@@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C29H44O6Si/c1-20(18-30)25(31)22(3)27(33)28(34-7)26(32)21(2)19-35-36(29(4,5)6,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,20-22,25,27-28,30-31,33H,18-19H2,1-7H3/t20-,21+,22+,25-,27-,28-/m0/s1 |
| InChIKey | VWWNETZKVYYZPX-FWKJKSSGSA-N |
| XLogP | 2.77 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|