About [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate
[4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate (PubChem CID 134846289) has the molecular formula C16H19F6IO6S2
and a molecular weight of 612.35 g/mol. Its IUPAC name is [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
| PubChem CID | 134846289 |
| Molecular Formula | C16H19F6IO6S2 |
| Molecular Weight | 612.35 g/mol |
| Exact Mass | 611.96 |
| IUPAC Name | [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(OS(=O)(=O)C(F)(F)F)c(I)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H19F6IO6S2/c1-13(2,3)8-7-9(14(4,5)6)12(29-31(26,27)16(20,21)22)10(23)11(8)28-30(24,25)15(17,18)19/h7H,1-6H3 |
| InChIKey | ICDVFDCXMQVMSS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 612.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate?
The IUPAC name of [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate (CID 134846289) is [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate is CC(C)(C)c1cc(C(C)(C)C)c(OS(=O)(=O)C(F)(F)F)c(I)c1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate?
The InChIKey is ICDVFDCXMQVMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F6IO6S2/c1-13(2,3)8-7-9(14(4,5)6)12(29-31(26,27)16(20,21)22)10(23)11(8)28-30(24,25)15(17,18)19/h7H,1-6H3.
What are the key properties of [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate?
[4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate has a molecular weight of 612.35 g/mol, XLogP of 5.34, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4,6-ditert-butyl-2-iodo-3-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 134846289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).