About CID 134846314
CID 134846314 (PubChem CID 134846314) has the molecular formula C28H49O3Si
and a molecular weight of 461.78 g/mol.
Molecular Properties
| Compound Name | CID 134846314 |
| PubChem CID | 134846314 |
| Molecular Formula | C28H49O3Si |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 461.35 |
| IUPAC Name | — |
| SMILES | C#C[C@@H](C)[C@H](CC[C@@H](C)[C@@H]1OC2(CC[C@@H](C)[C@H](CC[C@H](C)C=C)O2)CC[C@@H]1C)O[Si](C)C |
| InChI | InChI=1S/C28H49O3Si/c1-10-20(3)12-14-25-22(5)16-18-28(29-25)19-17-24(7)27(30-28)23(6)13-15-26(21(4)11-2)31-32(8)9/h2,10,20-27H,1,12-19H2,3-9H3/t20-,21-,22-,23-,24+,25+,26+,27+,28?/m1/s1 |
| InChIKey | RLQMNCAZYMOORI-GKHKVWEHSA-N |
| XLogP | 7.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 134846314 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134846314?
The IUPAC name of CID 134846314 (CID 134846314) is not available.
What is the SMILES notation for CID 134846314?
The canonical SMILES for CID 134846314 is C#C[C@@H](C)[C@H](CC[C@@H](C)[C@@H]1OC2(CC[C@@H](C)[C@H](CC[C@H](C)C=C)O2)CC[C@@H]1C)O[Si](C)C.
What is the InChIKey of CID 134846314?
The InChIKey is RLQMNCAZYMOORI-GKHKVWEHSA-N. The full InChI is InChI=1S/C28H49O3Si/c1-10-20(3)12-14-25-22(5)16-18-28(29-25)19-17-24(7)27(30-28)23(6)13-15-26(21(4)11-2)31-32(8)9/h2,10,20-27H,1,12-19H2,3-9H3/t20-,21-,22-,23-,24+,25+,26+,27+,28?/m1/s1.
What are the key properties of CID 134846314?
CID 134846314 has a molecular weight of 461.78 g/mol, XLogP of 7.24, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134846314 is sourced from PubChem (CID 134846314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).