C28H50O3Si — CID 134846315
(4S,5S)-5-[(3R)-3-[(2S,3S,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]butyl]-2,2,4-trimethyl-3-methylideneoxasilolane (PubChem CID 134846315) has the molecular formula C28H50O3Si and a molecular weight of 462.79 g/mol. Its IUPAC name is (4S,5S)-5-[(3R)-3-[(2S,3S,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]butyl]-2,2,4-trimethyl-3-methylideneoxasilolane.
| Compound Name | (4S,5S)-5-[(3R)-3-[(2S,3S,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]butyl]-2,2,4-trimethyl-3-methylideneoxasilolane |
|---|---|
| PubChem CID | 134846315 |
| Molecular Formula | C28H50O3Si |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | (4S,5S)-5-[(3R)-3-[(2S,3S,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]butyl]-2,2,4-trimethyl-3-methylideneoxasilolane |
| SMILES | C=C[C@@H](C)CC[C@@H]1OC2(CC[C@H]1C)CC[C@H](C)[C@H]([C@H](C)CC[C@@H]1O[Si](C)(C)C(=C)[C@H]1C)O2 |
| InChI | InChI=1S/C28H50O3Si/c1-10-19(2)11-13-25-20(3)15-17-28(29-25)18-16-22(5)27(30-28)21(4)12-14-26-23(6)24(7)32(8,9)31-26/h10,19-23,25-27H,1,7,11-18H2,2-6,8-9H3/t19-,20-,21-,22+,23-,25+,26+,27+,28?/m1/s1 |
| InChIKey | UQVDZJVNDKULPO-KKKJMJHESA-N |
| XLogP | 7.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|