C26H46O4 — CID 134846316
(3S,4S,7R)-7-[(2S,3S,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-4-hydroxy-3-methyloctan-2-one (PubChem CID 134846316) has the molecular formula C26H46O4 and a molecular weight of 422.65 g/mol. Its IUPAC name is (3S,4S,7R)-7-[(2S,3S,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-4-hydroxy-3-methyloctan-2-one.
| Compound Name | (3S,4S,7R)-7-[(2S,3S,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-4-hydroxy-3-methyloctan-2-one |
|---|---|
| PubChem CID | 134846316 |
| Molecular Formula | C26H46O4 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | (3S,4S,7R)-7-[(2S,3S,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-4-hydroxy-3-methyloctan-2-one |
| SMILES | C=C[C@@H](C)CC[C@@H]1OC2(CC[C@H]1C)CC[C@H](C)[C@H]([C@H](C)CC[C@H](O)[C@H](C)C(C)=O)O2 |
| InChI | InChI=1S/C26H46O4/c1-8-17(2)9-12-24-18(3)13-15-26(29-24)16-14-20(5)25(30-26)19(4)10-11-23(28)21(6)22(7)27/h8,17-21,23-25,28H,1,9-16H2,2-7H3/t17-,18-,19-,20+,21-,23+,24+,25+,26?/m1/s1 |
| InChIKey | RLHLTAGSVKXMJJ-OKEFWUQWSA-N |
| XLogP | 5.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|