C40H64O6Si2 — CID 134846358
methyl 2-[(2R,6S)-6-[(2R,4R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-7-methylnon-8-enyl]oxan-2-yl]acetate (PubChem CID 134846358) has the molecular formula C40H64O6Si2 and a molecular weight of 697.12 g/mol. Its IUPAC name is methyl 2-[(2R,6S)-6-[(2R,4R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-7-methylnon-8-enyl]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,6S)-6-[(2R,4R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-7-methylnon-8-enyl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 134846358 |
| Molecular Formula | C40H64O6Si2 |
| Molecular Weight | 697.12 g/mol |
| Exact Mass | 696.42 |
| IUPAC Name | methyl 2-[(2R,6S)-6-[(2R,4R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-7-methylnon-8-enyl]oxan-2-yl]acetate |
| SMILES | C=C[C@H](C)[C@H](O)C[C@H](C[C@@H](C[C@@H]1CCC[C@H](CC(=O)OC)O1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H64O6Si2/c1-12-30(2)37(41)28-34(45-47(10,11)39(3,4)5)27-33(26-31-20-19-21-32(44-31)29-38(42)43-9)46-48(40(6,7)8,35-22-15-13-16-23-35)36-24-17-14-18-25-36/h12-18,22-25,30-34,37,41H,1,19-21,26-29H2,2-11H3/t30-,31-,32+,33+,34-,37+/m0/s1 |
| InChIKey | QOPSOXSSZDWMNK-YBSNDBGFSA-N |
| XLogP | 8.18 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.12 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|