C14H15NO2 — CID 134846473
N-[(E,3R,4S)-4-hydroxy-1-phenylhex-1-en-5-yn-3-yl]acetamide (PubChem CID 134846473) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is N-[(E,3R,4S)-4-hydroxy-1-phenylhex-1-en-5-yn-3-yl]acetamide.
| Compound Name | N-[(E,3R,4S)-4-hydroxy-1-phenylhex-1-en-5-yn-3-yl]acetamide |
|---|---|
| PubChem CID | 134846473 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-[(E,3R,4S)-4-hydroxy-1-phenylhex-1-en-5-yn-3-yl]acetamide |
| SMILES | C#C[C@H](O)[C@@H](/C=C/c1ccccc1)NC(C)=O |
| InChI | InChI=1S/C14H15NO2/c1-3-14(17)13(15-11(2)16)10-9-12-7-5-4-6-8-12/h1,4-10,13-14,17H,2H3,(H,15,16)/b10-9+/t13-,14+/m1/s1 |
| InChIKey | FOAYURMYNVTBEN-HOQBHHMFSA-N |
| XLogP | 1.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|