C24H33NO5 — CID 134846518
dimethyl (E)-2-[(2S)-2-[(2-methylpropan-2-yl)oxymethyl]pyrrolidin-1-yl]-3-[(1S)-1-phenylprop-2-enyl]but-2-enedioate (PubChem CID 134846518) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is dimethyl (E)-2-[(2S)-2-[(2-methylpropan-2-yl)oxymethyl]pyrrolidin-1-yl]-3-[(1S)-1-phenylprop-2-enyl]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(2S)-2-[(2-methylpropan-2-yl)oxymethyl]pyrrolidin-1-yl]-3-[(1S)-1-phenylprop-2-enyl]but-2-enedioate |
|---|---|
| PubChem CID | 134846518 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | dimethyl (E)-2-[(2S)-2-[(2-methylpropan-2-yl)oxymethyl]pyrrolidin-1-yl]-3-[(1S)-1-phenylprop-2-enyl]but-2-enedioate |
| SMILES | C=C[C@H](/C(C(=O)OC)=C(/C(=O)OC)N1CCC[C@H]1COC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H33NO5/c1-7-19(17-12-9-8-10-13-17)20(22(26)28-5)21(23(27)29-6)25-15-11-14-18(25)16-30-24(2,3)4/h7-10,12-13,18-19H,1,11,14-16H2,2-6H3/b21-20+/t18-,19-/m0/s1 |
| InChIKey | HGUXYDODABUNQF-SXMUIAOJSA-N |
| XLogP | 3.84 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|