C9H10O4 — CID 134846521
(1S,5R,6R)-2-oxo-6-[(E)-prop-1-enyl]-3-oxabicyclo[3.1.0]hexane-1-carboxylic acid (PubChem CID 134846521) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is (1S,5R,6R)-2-oxo-6-[(E)-prop-1-enyl]-3-oxabicyclo[3.1.0]hexane-1-carboxylic acid.
| Compound Name | (1S,5R,6R)-2-oxo-6-[(E)-prop-1-enyl]-3-oxabicyclo[3.1.0]hexane-1-carboxylic acid |
|---|---|
| PubChem CID | 134846521 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (1S,5R,6R)-2-oxo-6-[(E)-prop-1-enyl]-3-oxabicyclo[3.1.0]hexane-1-carboxylic acid |
| SMILES | C/C=C/[C@@H]1[C@H]2COC(=O)[C@@]12C(=O)O |
| InChI | InChI=1S/C9H10O4/c1-2-3-5-6-4-13-8(12)9(5,6)7(10)11/h2-3,5-6H,4H2,1H3,(H,10,11)/b3-2+/t5-,6-,9+/m1/s1 |
| InChIKey | YHTGCGQNTZEWCB-OWSQRQHBSA-N |
| XLogP | 0.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|