C30H37NOSi2 — CID 134846535
N-[(1E,3R)-5,6-bis[dimethyl(phenyl)silyl]-1-phenylhexa-1,4-dien-3-yl]acetamide (PubChem CID 134846535) has the molecular formula C30H37NOSi2 and a molecular weight of 483.80 g/mol. Its IUPAC name is N-[(1E,3R)-5,6-bis[dimethyl(phenyl)silyl]-1-phenylhexa-1,4-dien-3-yl]acetamide.
| Compound Name | N-[(1E,3R)-5,6-bis[dimethyl(phenyl)silyl]-1-phenylhexa-1,4-dien-3-yl]acetamide |
|---|---|
| PubChem CID | 134846535 |
| Molecular Formula | C30H37NOSi2 |
| Molecular Weight | 483.80 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | N-[(1E,3R)-5,6-bis[dimethyl(phenyl)silyl]-1-phenylhexa-1,4-dien-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C=C(C[Si](C)(C)c1ccccc1)[Si](C)(C)c1ccccc1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C30H37NOSi2/c1-25(32)31-27(22-21-26-15-9-6-10-16-26)23-30(34(4,5)29-19-13-8-14-20-29)24-33(2,3)28-17-11-7-12-18-28/h6-23,27H,24H2,1-5H3,(H,31,32)/b22-21+,30-23?/t27-/m1/s1 |
| InChIKey | UFILLQLPCXWYIN-CUQOWNHVSA-N |
| XLogP | 5.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.80 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|